1115-47-5 N-Acetyl-DL-methionine
Produkt-Name |
N-Acetyl-DL-methionine |
Englischer Name |
N-Acetyl-DL-methionine; Ac-DL-Met-OH; D.L Methionine N, acetyl; N-acetylmethionine; (2R)-2-(acetylamino)-4-(methylsulfanyl)butanoate |
Molekulare Formel |
C7H12NO3S |
Molecular Weight |
190.2406 |
InChI |
InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/p-1/t6-/m1/s1 |
CAS Registry Number |
1115-47-5 |
EINECS |
214-224-3 |
Molecular Structure |
|
Schmelzpunkt |
117-119℃ |
Siedepunkt |
453.6°C at 760 mmHg |
Flammpunkt |
228.1°C |
Dampfdruck |
1.72E-09mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|