Details for L-Cysteine Hydrochloride Anhydrous

L-Cysteine Hydrochloride Anhydrous
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
52-89-1 |
EC NO: |
200-157-7 |
Molecular Formula: |
C3H7ClNO2S |
Molecular Weight: |
156.6117 |
Specification: |
|
InChI: |
InChI=1/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/p-1 |
Synonyms: |
L-Cysteine hydrochloride;L-cysteine hcl cell culture tested;H-Cys-OH.HCl;L-Cysteine Hcl Anhydrous;L-Cysteine HCl;Di-isopropyl nahpthalene;L-cysteine hydrochloride (1:1);L-Cysteine HCl anhydrate;cysteine, chloride (1:1);2-(2-Methoxy Ethoxy) Acetaldehyde Dimethyl Actal;L-Cysteine monohydrochloride; |
Molecular Structure: |
 |
if you are sourcing L-Cysteine Hydrochloride Anhydrous from United-States ,just feel free to inquire