Details for 3-Chlorobenzoic acid

3-Chlorobenzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
535-80-8 |
EC NO: |
208-618-4 |
Molecular Formula: |
C7H5ClO2 |
Molecular Weight: |
156.559 |
Specification: |
99% min |
InChI: |
InChI=1/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10)/p-1 |
Packing: |
25 kg drums |
Product description:
CAS N.535-80-8
Crystals or fluffy white powder. |
Synonyms: |
m-Chlorobenzoic Acid;3-chlorobenzoate; |
Molecular Structure: |
 |
if you are sourcing 3-Chlorobenzoic acid from Italy ,just feel free to inquire