Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
127-09-3 |
EC NO: |
204-823-8 |
Molecular Formula: |
C2H3NaO2 |
Molecular Weight: |
82.03 |
Specification: |
|
InChI: |
InChI=1/C2H4O2.Na.3H2O/c1-2(3)4;;;;/h1H3,(H,3,4);;3*1H2/q;+1;;;/p-1 |
Product description:
Eyes: Wear safety glasses with side shields. Skin: Wear appropriate gloves to prevent skin exposure. Clothing: Wear appropriate protective clothing to prevent skin exposure.
|
Uses: |
Textile dyes intermediates, textile dying and eletroplating. |
Synonyms: |
sodium ethanoate;Acetic acid sodium salt anhydrous;Sodium Acetate, Anhydrous;Anhydrous sodium acetate;Sodium acetate;Acetic acid, sodium salt;Acetic acid sodium salt;acetate sodium anhydrous;Sodium Acetate,Anhydrous; |
Molecular Structure: |
 |