Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
16051-77-7 |
EC NO: |
240-197-2 |
Molecular Formula: |
C6H7NO6 |
Molecular Weight: |
189.1229 |
Specification: |
|
InChI: |
InChI=1/C6H7NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h4-6H,1-2H2/t4-,5+,6+/m1/s1 |
Product description:
Isosorbide-5-mononitrate is a crystalline solid.Drug used in the treatment of angina pectoris, acts by dilating the blood vessels so as to reduce the blood pressure. |
Synonyms: |
Isosorbide mononitrate;1,4:3,6-dianhydro-5-O-nitro-D-glucitol;Isosorbide 5-mononitrate; |
Molecular Structure: |
 |