Details for Octopamine HCL
Octopamine HCL
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
770-05-8 |
| EC NO: |
212-216-4 |
| Molecular Formula: |
C8H12NO2 |
| Molecular Weight: |
154.1858 |
| Specification: |
|
| InChI: |
InChI=1/C8H11NO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,8,10-11H,5,9H2/p+1/t8-/m0/s1 |
| Synonyms: |
DL-Alpha-(Aminomethyl)-4-hydroxybenzyl alcohol hydrochloride;(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethanaminium;(2R)-2-hydroxy-2-(4-hydroxyphenyl)ethanaminium;Octopamine HCL;P-Hydroxyphenylaminoethanol Hydrochloride;Octopamine Hydrochloride;(+/-)-Octopamine Hydrochloride;Octapamine Hcl; |
| Molecular Structure: |
 |
if you are sourcing Octopamine HCL from China ,just feel free to inquire
CN
China Suppliers > sunwell-chem > 
Search Product