Details for Zinc Nitrate Hexahydrate
Zinc Nitrate Hexahydrate
| 111Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
10196-18-6 |
| EC NO: |
231-943-8 |
| Molecular Formula: |
H12NO9Zn |
| Molecular Weight: |
235.505 |
| Specification: |
|
| InChI: |
InChI=1/NO3.6H2O.Zn/c2-1(3)4;;;;;;;/h;6*1H2;/q-1;;;;;;;+2 |
| Synonyms: |
Zinc nitrate;ZN(NO3)2;ZINC ICP STANDARD, ZN(NO3)2;Zincnitrate(metalsbasis);Zinc nitrate hydrate;zinc dinitrate;methane, compd. with nitric acid, zinc salt (6:2:1); |
| Molecular Structure: |
 |
if you are sourcing Zinc Nitrate Hexahydrate from China ,just feel free to inquire
CN
China Suppliers > LINYI KEMELE CO., LTD. > 
Search Product