Details for Methyl 3-Nitro-2-Methyl benzoate

Methyl 3-Nitro-2-Methyl benzoate
Category: |
Organic chemicals and Derivatives/Aliphatic compounds |
|
CAS NO: |
59382-59-1 |
EC NO: |
|
Molecular Formula: |
C9H9NO4 |
Molecular Weight: |
195.1721 |
Specification: |
|
InChI: |
InChI=1/C9H9NO4/c1-6-7(9(11)14-2)4-3-5-8(6)10(12)13/h3-5H,1-2H3 |
Synonyms: |
2-Methyl-3-nitrobenzoic acid methyl ester;
methyl 2-methyl-3-nitrobenzenecarboxylate;Methyl-2-Methyl-3-Nitrobenzoate;Methyl 3-Nitro-2-Methyl benzoate;2-methyl-3-nitromethyl benzoate;2-Methyl-3-methyl nitrobenzene; |
Molecular Structure: |
 |
if you are sourcing Methyl 3-Nitro-2-Methyl benzoate from China ,just feel free to inquire