Details for Phenyl boronic acid
Phenyl boronic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
98-80-6 |
| EC NO: |
202-701-9 |
| Molecular Formula: |
C6H7BO2 |
| Molecular Weight: |
121.9296 |
| Specification: |
|
| InChI: |
InChI=1/C6H7BO2/c8-7(9)6-4-2-1-3-5-6/h1-5,8-9H |
| Synonyms: |
Benzeneboronicacidanhydride;Phenylboronic acid*;dihydroxy(phenyl)borane;Phenyl Boronic Acid;Phenylboric acid;Benzeneboronic acid;1-PHENYLSULPHONYLINDOLE-5-METHANOL;Phenylboron dihydroxide;acidephenylborique;borophenylicacid; |
| Molecular Structure: |
 |
if you are sourcing Phenyl boronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product