Details for Isopropyl 2-methylbutyrate

Isopropyl 2-methylbutyrate
Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
66576-71-4 |
EC NO: |
266-411-4 |
Molecular Formula: |
C8H16O2 |
Molecular Weight: |
144.2114 |
Specification: |
|
InChI: |
InChI=1/C8H16O2/c1-5-7(4)8(9)10-6(2)3/h6-7H,5H2,1-4H3 |
Synonyms: |
Butanoic acid, 2-methyl-, 1-methylethyl ester;1-Methylethyl 2-methylbutanoate;AI3-33626;FEMA No. 3699;Isopropyl 2-methylbutanoate;Isopropyl 2-methylbutyrate;propan-2-yl 2-methylbutanoate; |
Molecular Structure: |
 |
if you are sourcing Isopropyl 2-methylbutyrate from China ,just feel free to inquire