Details for 1,4-Cyclohexan dimethanol divinyl ether
1,4-Cyclohexan dimethanol divinyl ether
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
17351-75-6 |
| EC NO: |
|
| Molecular Formula: |
C9H16N2 |
| Molecular Weight: |
152.2367 |
| Specification: |
|
| InChI: |
InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| Synonyms: |
1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether; |
| Molecular Structure: |
 |
if you are sourcing 1,4-Cyclohexan dimethanol divinyl ether from China ,just feel free to inquire
CN
China Suppliers > xinjingchem > 
Search Product